Major Points*Chemical reactions usually give some kind of visual signal-a color changes, a solid forms, bubbles form, heat and/or flame is produced.
*a chemical equation represents a chemical reaction. Reactants are shown on the left side of the arrow and products are shown on the right. *A balanced chemical equation gives the relative numbers of reactant and product molecules. *four driving forces: formation of solid formation of liquid transferring of electrons formation of gas *a reaction where a solid is formed is called precipitation. *3 types of equations to describe reactions: molecular equation complete ionic net ionic *spectator ions are part of and aq solution that do not take part in the formation of a solid. *solubility is where an element/compound can dissolve in water ActivitiesRules for solubility:
http://quizlet.com/16779475/rules-for-solubility-flash-cards/ Balancing equations: http://www.files.chem.vt.edu/RVGS/ACT/notes/scripts/bal_eq1.html |
Online Resourcestips for balancing equations:
VideosSolubility:
http://www.youtube.com/watch?v=VJoKQ3ULCVs Balancing equations: http://www.youtube.com/watch?v=tz5SAGQZDj8 Example Calculations1. Is I2S soluble? no
2. write net ionic equation for HCL(aq) AgNO3(aq)-->AgCl(s)+HNO3(aq) Ag(aq)+1+Cl(aq)-1-->AgCl(s) 3. write the complete ionic for FeCl3(aq)+NaOH(aq)-->Fe(OH)3(s)+NaCl(aq) Fe(aq)+3+3Cl(aq)-1+Na(aq)+1+OH(aq)-1-->Fe(OH)3(s)+Na(aq)+1+Cl(aq)-1 4.Is tin (IV) chloride soluble? yes 5. what type of reaction is in #2? double displacement/precipitation 6. KO2+H2O-->KOH+O2+H2O2 2KO2+2H2O-->2KOH+O2+H2O2 7. Fe2O3+HNO3-->Fe(NO3)3+H2OFe2O3+6HNO3-->2Fe(NO3)3+3H2O 8. NH3+O2-->NO+H2O 4NH3+5O2-->4NO+6H2O 9.PCl5+H2O-->H3PO4+HCl PCl5+4H2O-->H3PO4+5HCl 10.Ba(NO3)2+Na2Cr)4-->BaCrO4+NaNO3 Ba(NO3)2+Na2Cr)4-->BaCrO4+2NaNO3 |